Difference between revisions of "3-Prime-Nucleoside-Monophosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16278 == * transcription-direction: ** negative * right-end-position: ** 5696 * left-end-position: ** 34 * centisome-position: ** 0.59223133 ==...")
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16278 ==
+
== Metabolite CPD-170 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** stachyose
−
* right-end-position:
+
* smiles:
−
** 5696
+
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
−
* left-end-position:
+
* inchi-key:
−
** 34
+
** uqziybxshagnoe-xnsrjbnmsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 0.59223133   
+
** 666.583
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.4.1.67-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-11501]]
−
* [[RXN-17809]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[2.4.1.67-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-8340]]
+
{{#set: common-name=stachyose}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=666.583}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6823]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=5696}}
 
−
{{#set: left-end-position=34}}
 
−
{{#set: centisome-position=0.59223133    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-170

  • common-name:
    • stachyose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
  • inchi-key:
    • uqziybxshagnoe-xnsrjbnmsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Prime-Nucleoside-Monophosphates&oldid=46767"