Difference between revisions of "3-Prime-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...")
(Created page with "Category:metabolite == Metabolite 3-Prime-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribonucleoside-3'-phosphate == Reaction(s) known to consume the compou...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11525 ==
+
== Metabolite 3-Prime-Phosphate-Terminated-RNAs ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
+
** an [rna]-3'-ribonucleoside-3'-phosphate
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 
* inchi-key:
 
** yyuzysvpfvoylb-rguwmiccsa-j
 
* molecular-weight:
 
** 983.813
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10707]]
+
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10700]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
+
{{#set: common-name=an [rna]-3'-ribonucleoside-3'-phosphate}}
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
 
{{#set: molecular-weight=983.813}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 3-Prime-Phosphate-Terminated-RNAs

  • common-name:
    • an [rna]-3'-ribonucleoside-3'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [rna]-3'-ribonucleoside-3'-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.