Difference between revisions of "3-Prime-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14913 == * transcription-direction: ** negative * right-end-position: ** 184552 * left-end-position: ** 183758 * centisome-position: ** 60.31121...")
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ14913 ==
+
== Metabolite CPD-11525 ==
* transcription-direction:
+
* common-name:
** negative
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
* right-end-position:
+
* smiles:
** 184552
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
* left-end-position:
+
* inchi-key:
** 183758
+
** yyuzysvpfvoylb-rguwmiccsa-j
* centisome-position:
+
* molecular-weight:
** 60.31121   
+
** 983.813
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10707]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.7.12.1-RXN]]
+
* [[RXN-10700]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
* [[PROTEIN-KINASE-RXN]]
+
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=983.813}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-14906]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=184552}}
 
{{#set: left-end-position=183758}}
 
{{#set: centisome-position=60.31121    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-11525

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
  • inchi-key:
    • yyuzysvpfvoylb-rguwmiccsa-j
  • molecular-weight:
    • 983.813

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality