Difference between revisions of "3-SULFINOALANINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-986 RXN0-986] == * direction: ** left-to-right * common-name: ** 1-ethyladenine demethylase *...") |
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-SULFINOALANINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-sulfinoalanine |
− | * | + | * smiles: |
− | ** | + | ** c(c([n+])c(=o)[o-])s([o-])=o |
− | + | * inchi-key: | |
− | + | ** advptqaunprnpo-reohclbhsa-m | |
− | + | * molecular-weight: | |
− | * | + | ** 152.145 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
− | * | + | * [[CYSTEINE-DIOXYGENASE-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-sulfinoalanine}} | |
− | {{#set: common-name= | + | {{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}} |
− | {{#set: | + | {{#set: molecular-weight=152.145}} |
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 3-SULFINOALANINE
- common-name:
- 3-sulfinoalanine
- smiles:
- c(c([n+])c(=o)[o-])s([o-])=o
- inchi-key:
- advptqaunprnpo-reohclbhsa-m
- molecular-weight:
- 152.145