Difference between revisions of "3-SULFINOALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-986 RXN0-986] == * direction: ** left-to-right * common-name: ** 1-ethyladenine demethylase *...")
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-986 RXN0-986] ==
+
== Metabolite 3-SULFINOALANINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1-ethyladenine demethylase
+
** 3-sulfinoalanine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.11.33 ec-1.14.11.33]
+
** c(c([n+])c(=o)[o-])s([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[an-iNisup1sup-ethyladenine-in-DNA]][c] '''=>''' 1 [[ACETALD]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[DNA-Adenines]][c] '''+''' 1 [[SUC]][c]
+
** advptqaunprnpo-reohclbhsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10887]]
+
** 152.145
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[CYSTEINE-DIOXYGENASE-RXN]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=3-sulfinoalanine}}
−
{{#set: common-name=1-ethyladenine demethylase}}
+
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
−
{{#set: ec-number=ec-1.14.11.33}}
+
{{#set: molecular-weight=152.145}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-SULFINOALANINE

  • common-name:
    • 3-sulfinoalanine
  • smiles:
    • c(c([n+])c(=o)[o-])s([o-])=o
  • inchi-key:
    • advptqaunprnpo-reohclbhsa-m
  • molecular-weight:
    • 152.145

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-SULFINOALANINE&oldid=138572"