Difference between revisions of "3-SULFINOALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-Alcohols == * common-name: ** a very long chain alcohol == Reaction(s) known to consume the compound == * RXNQT-4193...")
(Created page with "Category:metabolite == Metabolite CPD-14419 == * common-name: ** 3r-hydroxy-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Very-Long-Chain-Alcohols ==
+
== Metabolite CPD-14419 ==
 
* common-name:
 
* common-name:
** a very long chain alcohol
+
** 3r-hydroxy-icosatrienoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** aukmttjfpkefdq-ivictrqzsa-j
 +
* molecular-weight:
 +
** 1067.974
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNQT-4193]]
+
* [[RXN-13001]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12994]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a very long chain alcohol}}
+
{{#set: common-name=3r-hydroxy-icosatrienoyl-coa}}
 +
{{#set: inchi-key=inchikey=aukmttjfpkefdq-ivictrqzsa-j}}
 +
{{#set: molecular-weight=1067.974}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-14419

  • common-name:
    • 3r-hydroxy-icosatrienoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • aukmttjfpkefdq-ivictrqzsa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality