Difference between revisions of "3-SULFINYL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17488 == * transcription-direction: ** positive * right-end-position: ** 253488 * left-end-position: ** 244658 * centisome-position: ** 93.58201...")
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17488 ==
+
== Metabolite 3-SULFINYL-PYRUVATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-sulfinopyruvate
−
* right-end-position:
+
* smiles:
−
** 253488
+
** c(s([o-])=o)c(=o)c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 244658
+
** jxylqemxcaamol-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 93.58201   
+
** 150.106
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-sulfinopyruvate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=150.106}}
−
* [[RXN-1102]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-1125]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-7644]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SBTD_D2]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-361]]
 
−
** '''7''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-4101]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=253488}}
 
−
{{#set: left-end-position=244658}}
 
−
{{#set: centisome-position=93.58201    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-SULFINYL-PYRUVATE

  • common-name:
    • 3-sulfinopyruvate
  • smiles:
    • c(s([o-])=o)c(=o)c(=o)[o-]
  • inchi-key:
    • jxylqemxcaamol-uhfffaoysa-l
  • molecular-weight:
    • 150.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-SULFINYL-PYRUVATE&oldid=136639"