Difference between revisions of "3-SULFINYL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NAD-P-OR-NOP == * common-name: ** nad(p)+ == Reaction(s) known to consume the compound == <div class="toccolours mw-collapsible mw-collap...")
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NAD-P-OR-NOP ==
+
== Metabolite 3-SULFINYL-PYRUVATE ==
 
* common-name:
 
* common-name:
** nad(p)+
+
** 3-sulfinopyruvate
 +
* smiles:
 +
** c(s([o-])=o)c(=o)c(=o)[o-]
 +
* inchi-key:
 +
** jxylqemxcaamol-uhfffaoysa-l
 +
* molecular-weight:
 +
** 150.106
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
* [[1.1.1.170-RXN]]
 
* [[1.1.1.51-RXN]]
 
* [[1.6.4.4-RXN]]
 
* [[6PGLUCONDEHYDROG-RXN]]
 
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 
* [[ALDEHYDE-REDUCTASE-RXN]]
 
* [[GAPDHSYNEC-RXN]]
 
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 
* [[RXN-12303]]
 
* [[RXN-13118]]
 
* [[RXN-13926]]
 
* [[RXN-14819]]
 
* [[RXN-2962]]
 
* [[RXN-5581]]
 
* [[RXN-6382]]
 
* [[RXN-7967]]
 
* [[RXN-7968]]
 
* [[RXN-9958]]
 
* [[RXN0-5293]]
 
* [[RXN66-18]]
 
* [[RXN66-23]]
 
* [[RXN66-313]]
 
* [[RXN66-318]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
* [[1.1.1.170-RXN]]
 
* [[1.5.1.25-RXN]]
 
* [[1.6.4.4-RXN]]
 
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 
* [[ALDEHYDE-REDUCTASE-RXN]]
 
* [[ESTRADIOL-17-BETA-DEHYDROGENASE-RXN]]
 
* [[GAPDHSYNEC-RXN]]
 
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 
* [[HOMOSERDEHYDROG-RXN]]
 
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
 
* [[NQOR-RXN]]
 
* [[PYRROLINECARBREDUCT-RXN]]
 
* [[R621-RXN]]
 
* [[RXN-10745]]
 
* [[RXN-12303]]
 
* [[RXN-12445]]
 
* [[RXN-12454]]
 
* [[RXN-12455]]
 
* [[RXN-12456]]
 
* [[RXN-12457]]
 
* [[RXN-12968]]
 
* [[RXN-12994]]
 
* [[RXN-13162]]
 
* [[RXN-13443]]
 
* [[RXN-13926]]
 
* [[RXN-14014]]
 
* [[RXN-14819]]
 
* [[RXN-15029]]
 
* [[RXN-16020]]
 
* [[RXN-17335]]
 
* [[RXN-9563]]
 
* [[RXN0-6377]]
 
* [[RXN66-281]]
 
* [[RXN66-546]]
 
* [[TSA-REDUCT-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nad(p)+}}
+
{{#set: common-name=3-sulfinopyruvate}}
 +
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
 +
{{#set: molecular-weight=150.106}}

Latest revision as of 11:11, 18 March 2021

Metabolite 3-SULFINYL-PYRUVATE

  • common-name:
    • 3-sulfinopyruvate
  • smiles:
    • c(s([o-])=o)c(=o)c(=o)[o-]
  • inchi-key:
    • jxylqemxcaamol-uhfffaoysa-l
  • molecular-weight:
    • 150.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality