Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9007 == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite CPD-11975 == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate * smiles: ** cc(=o)nc2(c(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9007 ==
+
== Metabolite CPD-11975 ==
 
* common-name:
 
* common-name:
** adp ribose 1'',2''-cyclic phosphate
+
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
+
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
 
* inchi-key:
 
* inchi-key:
** npspryxpogpcpm-tyasjmozsa-k
+
** chttvmdqgbocme-dnswdbfxsa-l
 
* molecular-weight:
 
* molecular-weight:
** 618.26
+
** 461.316
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.160-RXN]]
+
* [[RXN-6501]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adp ribose 1'',2''-cyclic phosphate}}
+
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
{{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
+
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
{{#set: molecular-weight=618.26}}
+
{{#set: molecular-weight=461.316}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-11975

  • common-name:
    • 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
  • smiles:
    • cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
  • inchi-key:
    • chttvmdqgbocme-dnswdbfxsa-l
  • molecular-weight:
    • 461.316

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality