Difference between revisions of "3-carboxy-3-dimethylammonio-propyl-L-his"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12829 == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(...")
(Created page with "Category:metabolite == Metabolite CPD-14271 == * common-name: ** 3-oxoicosanoyl-coa * smiles: ** cccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12829 ==
+
== Metabolite CPD-14271 ==
 
* common-name:
 
* common-name:
** plastoquinol-9
+
** 3-oxoicosanoyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
+
** cccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** ijbljlrewplepb-iqsnhbbhsa-n
+
** fybvhnzjdvuvlj-ibyujnrcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 751.23
+
** 1072.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13298]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2762]]
+
* [[RXN-13294]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=plastoquinol-9}}
+
{{#set: common-name=3-oxoicosanoyl-coa}}
{{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}}
+
{{#set: inchi-key=inchikey=fybvhnzjdvuvlj-ibyujnrcsa-j}}
{{#set: molecular-weight=751.23}}
+
{{#set: molecular-weight=1072.006}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-14271

  • common-name:
    • 3-oxoicosanoyl-coa
  • smiles:
    • cccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • fybvhnzjdvuvlj-ibyujnrcsa-j
  • molecular-weight:
    • 1072.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality