Difference between revisions of "3-hydroxy-cis-D9-hexaecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HYDROXYPHYTANOYL-COA == * common-name: ** 2-hydroxyphytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HYDROXYPHYTANOYL-COA ==
+
== Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** 2-hydroxyphytanoyl-coa
+
** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wnvfjmypvbolkv-ylnukallsa-j
 
* molecular-weight:
 
** 1074.021
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.11.18-RXN]]
+
* [[RXN-10659]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxyphytanoyl-coa}}
+
{{#set: common-name=a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]}}
{{#set: inchi-key=inchikey=wnvfjmypvbolkv-ylnukallsa-j}}
 
{{#set: molecular-weight=1074.021}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.