Difference between revisions of "3-hydroxy-cis-D9-hexaecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HYDROXYPHYTANOYL-COA == * common-name: ** 2-hydroxyphytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HYDROXYPHYTANOYL-COA ==
+
== Metabolite Alpha-tubulins ==
 
* common-name:
 
* common-name:
** 2-hydroxyphytanoyl-coa
+
** α-tubulin
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wnvfjmypvbolkv-ylnukallsa-j
 
* molecular-weight:
 
** 1074.021
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.11.18-RXN]]
+
* [[6.3.2.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxyphytanoyl-coa}}
+
{{#set: common-name=α-tubulin}}
{{#set: inchi-key=inchikey=wnvfjmypvbolkv-ylnukallsa-j}}
 
{{#set: molecular-weight=1074.021}}
 

Revision as of 13:11, 14 January 2021

Metabolite Alpha-tubulins

  • common-name:
    • α-tubulin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality