Difference between revisions of "3-hydroxy-cis-D9-hexaecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Alpha-tubulins ==
+
== Metabolite CPD-13397 ==
 
* common-name:
 
* common-name:
** α-tubulin
+
** l-alanyl-l-threonine
 +
* smiles:
 +
** cc([n+])c(=o)nc(c(o)c)c([o-])=o
 +
* inchi-key:
 +
** buqichwnxbibog-lmvfsukvsa-n
 +
* molecular-weight:
 +
** 190.199
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6980]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.2.25-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-tubulin}}
+
{{#set: common-name=l-alanyl-l-threonine}}
 +
{{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}}
 +
{{#set: molecular-weight=190.199}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-13397

  • common-name:
    • l-alanyl-l-threonine
  • smiles:
    • cc([n+])c(=o)nc(c(o)c)c([o-])=o
  • inchi-key:
    • buqichwnxbibog-lmvfsukvsa-n
  • molecular-weight:
    • 190.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality