Difference between revisions of "3-methylcrotonoyl-CoA-carboxylase-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * smiles: ** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) * in...") |
(Created page with "Category:metabolite == Metabolite 3-methylcrotonoyl-CoA-carboxylase-lysine == * common-name: ** a [3-methylcrotonoyl-coa-carboxylase]-l-lysine == Reaction(s) known to cons...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-methylcrotonoyl-CoA-carboxylase-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [3-methylcrotonoyl-coa-carboxylase]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6.3.4.11-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [3-methylcrotonoyl-coa-carboxylase]-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 3-methylcrotonoyl-CoA-carboxylase-lysine
- common-name:
- a [3-methylcrotonoyl-coa-carboxylase]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [3-methylcrotonoyl-coa-carboxylase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
