Difference between revisions of "3-methylcrotonoyl-CoA-carboxylase-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16632 == * transcription-direction: ** positive * right-end-position: ** 50968 * left-end-position: ** 23120 * centisome-position: ** 8.296224...")
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16632 ==
+
== Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** leukotriene b4
−
* right-end-position:
+
* smiles:
−
** 50968
+
** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 23120
+
** vnyssyrcgwbhlg-amolwhmgsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 8.296224   
+
** 335.462
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
+
{{#set: common-name=leukotriene b4}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=335.462}}
−
* [[LIPOXYGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-1321]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13395]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8497]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-8647]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-375]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5410]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5409]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-735]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY66-392]]
 
−
** '''1''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-6917]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5406]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5407]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5408]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=50968}}
 
−
{{#set: left-end-position=23120}}
 
−
{{#set: centisome-position=8.296224    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=9}}
 

Revision as of 20:32, 18 December 2020

Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI

  • common-name:
    • leukotriene b4
  • smiles:
    • cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
  • inchi-key:
    • vnyssyrcgwbhlg-amolwhmgsa-m
  • molecular-weight:
    • 335.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-methylcrotonoyl-CoA-carboxylase-lysine&oldid=46255"