Difference between revisions of "3-methylcrotonoyl-CoA-carboxylase-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * smiles: ** c(nc1(=cc=c(c(=o)[o-])c=c1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-67 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phosphoglycolate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(op([o-])(=o)[o-])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ascfnmcahfubco-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.008 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GPH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phosphoglycolate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.008}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-67
- common-name:
- 2-phosphoglycolate
- smiles:
- c(op([o-])(=o)[o-])c([o-])=o
- inchi-key:
- ascfnmcahfubco-uhfffaoysa-k
- molecular-weight:
- 153.008
