Difference between revisions of "3-oxo-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-90 == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3) * inchi-key: ** iyrmwmyz...")
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-90 ==
+
== Metabolite 3-oxo-D5-steroids ==
 
* common-name:
 
* common-name:
** kaempferol
+
** a 3-oxo-δ5-steroid
* smiles:
 
** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3)
 
* inchi-key:
 
** iyrmwmyzsqpjkc-uhfffaoysa-m
 
* molecular-weight:
 
** 285.232
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12510]]
+
* [[1.1.1.145-RXN]]
* [[RXN-13935]]
 
* [[RXN1F-461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-93]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kaempferol}}
+
{{#set: common-name=a 3-oxo-δ5-steroid}}
{{#set: inchi-key=inchikey=iyrmwmyzsqpjkc-uhfffaoysa-m}}
 
{{#set: molecular-weight=285.232}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-oxo-D5-steroids

  • common-name:
    • a 3-oxo-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality