Difference between revisions of "3-oxo-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9873 == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9873 ==
+
== Metabolite 3-oxo-D5-steroids ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-10
+
** a 3-oxo-δ5-steroid
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
** vlmqnhnmqvlpqi-avrcvibksa-n
 
* molecular-weight:
 
** 851.347
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9237]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-10}}
+
{{#set: common-name=a 3-oxo-δ5-steroid}}
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
 
{{#set: molecular-weight=851.347}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-oxo-D5-steroids

  • common-name:
    • a 3-oxo-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality