Difference between revisions of "3-oxo-D5-steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-90 == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3) * inchi-key: ** iyrmwmyz...") |
(Created page with "Category:metabolite == Metabolite CPD-18888 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18888 == |
+ | * smiles: | ||
+ | ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9)))))) | ||
* common-name: | * common-name: | ||
− | ** | + | ** tetrahydrogeranylgeranyl bacteriochlorophyllide b |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 906.478 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17482]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17484]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tetrahydrogeranylgeranyl bacteriochlorophyllide b}} |
− | + | {{#set: molecular-weight=906.478}} | |
− | {{#set: molecular-weight= |
Revision as of 15:28, 5 January 2021
Contents
Metabolite CPD-18888
- smiles:
- cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
- common-name:
- tetrahydrogeranylgeranyl bacteriochlorophyllide b
- molecular-weight:
- 906.478