Difference between revisions of "3-oxo-arachidoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o...")
(Created page with "Category:metabolite == Metabolite Hypoxanthine-37-In-tRNA-Alanines == * common-name: ** a hypoxanthine37 in trnaala == Reaction(s) known to consume the compound == * RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8890 ==
+
== Metabolite Hypoxanthine-37-In-tRNA-Alanines ==
 
* common-name:
 
* common-name:
** betanidin quinone
+
** a hypoxanthine37 in trnaala
* smiles:
 
** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
 
* inchi-key:
 
** mcthlmsflmebek-aaeuagobsa-l
 
* molecular-weight:
 
** 384.301
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13996]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8635]]
+
* [[RXN-13996]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=betanidin quinone}}
+
{{#set: common-name=a hypoxanthine37 in trnaala}}
{{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}}
 
{{#set: molecular-weight=384.301}}
 

Revision as of 11:15, 15 January 2021

Metabolite Hypoxanthine-37-In-tRNA-Alanines

  • common-name:
    • a hypoxanthine37 in trnaala

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality