Difference between revisions of "3-oxo-arachidoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite 3-oxo-arachidoyl-ACPs == * common-name: ** a 3-oxo-arachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-349 == Re...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-oxo-arachidoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** a 3-oxo-arachidoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1G-349]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1G-368]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3-[ | + | {{#set: common-name=a 3-oxo-arachidoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-oxo-arachidoyl-ACPs
- common-name:
- a 3-oxo-arachidoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-arachidoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.