Difference between revisions of "3-oxo-arachidoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8890 == |
* common-name: | * common-name: | ||
| − | ** | + | ** betanidin quinone |
* smiles: | * smiles: | ||
| − | ** c(c( | + | ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mcthlmsflmebek-aaeuagobsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 384.301 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8635]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=betanidin quinone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=384.301}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-8890
- common-name:
- betanidin quinone
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
- inchi-key:
- mcthlmsflmebek-aaeuagobsa-l
- molecular-weight:
- 384.301
