Difference between revisions of "3-oxo-behenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o *...")
(Created page with "Category:metabolite == Metabolite 3-oxo-behenoyl-ACPs == * common-name: ** a 3-oxo-behenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-157 * RXN1G...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8268 ==
+
== Metabolite 3-oxo-behenoyl-ACPs ==
 
* common-name:
 
* common-name:
** dioleoyl phosphatidate
+
** a 3-oxo-behenoyl-[acp]
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
** mhuwzntuiifhas-dssvuwshsa-l
 
* molecular-weight:
 
** 698.959
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15068]]
+
* [[RXN1G-157]]
 +
* [[RXN1G-460]]
 +
* [[RXN1G-469]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15043]]
+
* [[RXN1G-445]]
 +
* [[RXN1G-460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dioleoyl phosphatidate}}
+
{{#set: common-name=a 3-oxo-behenoyl-[acp]}}
{{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}}
 
{{#set: molecular-weight=698.959}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 3-oxo-behenoyl-ACPs

  • common-name:
    • a 3-oxo-behenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-behenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.