Difference between revisions of "3-oxo-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE == * common-name: ** phylloquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c...")
(Created page with "Category:metabolite == Metabolite Phosphatase-2A-leucine-methyl-ester == * common-name: ** a [phosphatase 2a protein] c-terminal l-leucine methyl ester == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE ==
+
== Metabolite Phosphatase-2A-leucine-methyl-ester ==
 
* common-name:
 
* common-name:
** phylloquinone
+
** a [phosphatase 2a protein] c-terminal l-leucine methyl ester
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
 
* inchi-key:
 
** mbwxntaxlnyfjb-lkudqcmesa-n
 
* molecular-weight:
 
** 450.703
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-12322]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phylloquinone}}
+
{{#set: common-name=a [phosphatase 2a protein] c-terminal l-leucine methyl ester}}
{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
 
{{#set: molecular-weight=450.703}}
 

Revision as of 15:24, 5 January 2021

Metabolite Phosphatase-2A-leucine-methyl-ester

  • common-name:
    • a [phosphatase 2a protein] c-terminal l-leucine methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [phosphatase 2a protein] c-terminal l-leucine methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.