Difference between revisions of "3-oxo-cis-D9-hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12935 ==
+
== Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** 4'-apo-β-carotenal
+
** a 3-oxo-cis-δ9-hexadecenoyl-[acp]
* smiles:
 
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
 
* inchi-key:
 
** ftqsfezuhzhoat-brzoagjpsa-n
 
* molecular-weight:
 
** 482.748
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10659]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11989]]
+
* [[RXN-10658]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-apo-β-carotenal}}
+
{{#set: common-name=a 3-oxo-cis-δ9-hexadecenoyl-[acp]}}
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
 
{{#set: molecular-weight=482.748}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs

  • common-name:
    • a 3-oxo-cis-δ9-hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-cis-δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.