Difference between revisions of "3-oxo-cis-D9-hexadecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DTDP-D-GLUCOSE == |
* common-name: | * common-name: | ||
− | ** & | + | ** dtdp-α-d-glucose |
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ysykrgrsmltjnl-urarbognsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 562.317 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DTDPGLUCDEHYDRAT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=& | + | {{#set: common-name=dtdp-α-d-glucose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=562.317}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite DTDP-D-GLUCOSE
- common-name:
- dtdp-α-d-glucose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
- inchi-key:
- ysykrgrsmltjnl-urarbognsa-l
- molecular-weight:
- 562.317