Difference between revisions of "3-oxo-cis-vaccenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14280 == * common-name: ** trans-arachido-2-enoyl-coa * smiles: ** cccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op(...") |
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-609 == |
* common-name: | * common-name: | ||
− | ** | + | ** p1,p4-bis(5'-guanosyl) tetraphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** olgwxcqxrssqpo-mharetsrsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 864.359 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.6.1.17-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=864.359}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite CPD-609
- common-name:
- p1,p4-bis(5'-guanosyl) tetraphosphate
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
- inchi-key:
- olgwxcqxrssqpo-mharetsrsa-j
- molecular-weight:
- 864.359