Difference between revisions of "3-oxo-cis-vaccenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-vaccenoyl-ACPs == * common-name: ** a 3-oxo-cis-vacc-11-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-955...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-CITRULLINE ==
+
== Metabolite 3-oxo-cis-vaccenoyl-ACPs ==
 
* common-name:
 
* common-name:
** l-citrulline
+
** a 3-oxo-cis-vacc-11-enoyl-[acp]
* smiles:
 
** c(nc(n)=o)ccc([n+])c(=o)[o-]
 
* inchi-key:
 
** rhgklrlohdjjdr-bypyzucnsa-n
 
* molecular-weight:
 
** 175.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGSUCCINSYN-RXN]]
+
* [[RXN-9556]]
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13482]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHYLARGININASE-RXN]]
+
* [[2.3.1.179-RXN]]
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13482]]
 
* [[RXN-13565]]
 
* [[RXN-7933]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-citrulline}}
+
{{#set: common-name=a 3-oxo-cis-vacc-11-enoyl-[acp]}}
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
 
{{#set: molecular-weight=175.187}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite 3-oxo-cis-vaccenoyl-ACPs

  • common-name:
    • a 3-oxo-cis-vacc-11-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-cis-vacc-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.