Difference between revisions of "3-oxo-cis-vaccenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.75-RXN 2.3.1.75-RXN] == * direction: ** left-to-right * common-name: ** long-chain-alcohol o-...")
(Created page with "Category:metabolite == Metabolite CPD-15652 == * common-name: ** (3r)-hydroxy, 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.75-RXN 2.3.1.75-RXN] ==
+
== Metabolite CPD-15652 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** long-chain-alcohol o-fatty-acyltransferase
+
** (3r)-hydroxy, 6-trans-tridecenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.75 ec-2.3.1.75]
+
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Long-Chain-Acyl-CoAs]][c] '''+''' 1 [[Long-chain-alcohols]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[LC-alcohol-LC-acyl-ester]][c]
+
** adzjvtnixnsngu-ovqifrbasa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ01916]]
+
** 973.818
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ18627]]
+
* [[RXN-14786]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(3r)-hydroxy, 6-trans-tridecenoyl-coa}}
−
* Gene: [[SJ02128]]
+
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ovqifrbasa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=973.818}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ21726]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5885]], wax esters biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5885 PWY-5885]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5884]], wax esters biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5884 PWY-5884]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01999 R01999]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=long-chain-alcohol o-fatty-acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.75}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-15652

  • common-name:
    • (3r)-hydroxy, 6-trans-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ovqifrbasa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-oxo-cis-vaccenoyl-ACPs&oldid=48639"