Difference between revisions of "3-oxo-decanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA == * common-name: ** an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15276]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein]}} |
| − | |||
| − | |||
Revision as of 11:18, 15 January 2021
Contents
Metabolite N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA
- common-name:
- an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-(1→3)-β-d-galactosyl-(1→4)-n-acetyl-d-glucosaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
