Difference between revisions of "3-oxo-dodecanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3187 == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2)) * inchi-key: ** boqrppfuushfgw-snvbaglbsa...") |
(Created page with "Category:metabolite == Metabolite CPD1F-95 == * common-name: ** gibberellin a12 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-95 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a12 |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ujfqjdaesqjxtg-ufuzvnnqsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 330.423 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1F-162]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-161]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a12}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ujfqjdaesqjxtg-ufuzvnnqsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=330.423}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD1F-95
- common-name:
- gibberellin a12
- smiles:
- c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
- inchi-key:
- ujfqjdaesqjxtg-ufuzvnnqsa-l
- molecular-weight:
- 330.423
