Difference between revisions of "3-oxo-hexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UROPORPHYRINOGEN-III == * common-name: ** uroporphyrinogen-iii * smiles: ** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])c...")
(Created page with "Category:metabolite == Metabolite D-Ribofuranose == * common-name: ** d-ribofuranose == Reaction(s) known to consume the compound == * RXN-4315 == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UROPORPHYRINOGEN-III ==
+
== Metabolite D-Ribofuranose ==
 
* common-name:
 
* common-name:
** uroporphyrinogen-iii
+
** d-ribofuranose
* smiles:
 
** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-])
 
* inchi-key:
 
** huhwzxwwofsfkf-uhfffaoysa-f
 
* molecular-weight:
 
** 828.742
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13403]]
+
* [[RXN-4315]]
* [[UROGENDECARBOX-RXN]]
 
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENIIISYN-RXN]]
+
* [[PURINE-NUCLEOSIDASE-RXN]]
 +
* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
 +
* [[RXN-4315]]
 +
* [[RXN0-361]]
 +
* [[RXN0-363]]
 +
* [[RXN0-366]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uroporphyrinogen-iii}}
+
{{#set: common-name=d-ribofuranose}}
{{#set: inchi-key=inchikey=huhwzxwwofsfkf-uhfffaoysa-f}}
 
{{#set: molecular-weight=828.742}}
 

Revision as of 08:29, 15 March 2021

Metabolite D-Ribofuranose

  • common-name:
    • d-ribofuranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality