Difference between revisions of "3-oxo-hexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...")
(Created page with "Category:metabolite == Metabolite 3-oxo-hexanoyl-ACPs == * common-name: ** a 3-oxo-hexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9518 == Reactio...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-725 ==
+
== Metabolite 3-oxo-hexanoyl-ACPs ==
 
* common-name:
 
* common-name:
** 13(s)-hpote
+
** a 3-oxo-hexanoyl-[acp]
* smiles:
 
** ccc=ccc(c=cc=ccccccccc([o-])=o)oo
 
* inchi-key:
 
** uyqgvdxdxbaabn-fqsphkrjsa-m
 
* molecular-weight:
 
** 309.425
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-19]]
+
* [[RXN-9518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1321]]
+
* [[RXN-9516]]
 +
* [[RXN-9648]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=13(s)-hpote}}
+
{{#set: common-name=a 3-oxo-hexanoyl-[acp]}}
{{#set: inchi-key=inchikey=uyqgvdxdxbaabn-fqsphkrjsa-m}}
 
{{#set: molecular-weight=309.425}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-oxo-hexanoyl-ACPs

  • common-name:
    • a 3-oxo-hexanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-hexanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.