Difference between revisions of "3-oxo-myristoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...")
(Created page with "Category:metabolite == Metabolite 3-oxo-myristoyl-ACPs == * common-name: ** a 3-oxo-myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9536 == React...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UBIQUINONE-8 ==
+
== Metabolite 3-oxo-myristoyl-ACPs ==
 
* common-name:
 
* common-name:
** ubiquinone-8
+
** a 3-oxo-myristoyl-[acp]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
 
* inchi-key:
 
** icfizjqgjajrsu-sghxuwjisa-n
 
* molecular-weight:
 
** 727.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R00281]]
+
* [[RXN-9536]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R00281]]
+
* [[RXN-9535]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
+
* [[RXN-9653]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinone-8}}
+
{{#set: common-name=a 3-oxo-myristoyl-[acp]}}
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
 
{{#set: molecular-weight=727.121}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 3-oxo-myristoyl-ACPs

  • common-name:
    • a 3-oxo-myristoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-myristoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.