Difference between revisions of "3-oxo-myristoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBNOm HBNOm] == * direction: ** reversible * common-name: ** 3-hydroxybutanoate:nad+ oxidoreductase...")
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBNOm HBNOm] ==
+
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** 3-hydroxybutanoate:nad+ oxidoreductase, mitochondria
+
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
== Reaction formula ==
+
* smiles:
* 1.0 [[CPD-335]][m] '''+''' 1.0 [[NAD]][m] '''<=>''' 1.0 [[3-KETOBUTYRATE]][m] '''+''' 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m]
+
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
== Gene(s) associated with this reaction  ==
+
* inchi-key:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** rqmcndrmpzbeod-uhfffaoysa-k
* Gene: [[SJ21322]]
+
* molecular-weight:
** Category: [[orthology]]
+
** 217.112
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ05277]]
+
* [[RXN-2464]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-2464]]
* Gene: [[SJ05275]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
* Gene: [[SJ05276]]
+
{{#set: molecular-weight=217.112}}
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ05274]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ21312]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ10028]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ20291]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ20292]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=reversible}}
 
{{#set: common-name=3-hydroxybutanoate:nad+ oxidoreductase, mitochondria}}
 
{{#set: nb gene associated=9}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE

  • common-name:
    • 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
  • smiles:
    • c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
  • inchi-key:
    • rqmcndrmpzbeod-uhfffaoysa-k
  • molecular-weight:
    • 217.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality