Difference between revisions of "3-oxo-myristoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite HS == * common-name: ** hydrogen sulfide * smiles: ** [sh2] * inchi-key: ** rwsotubldixvet-uhfffaoysa-n * molecular-weight: ** 34.076 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
+
== Metabolite HS ==
 
* common-name:
 
* common-name:
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+
** hydrogen sulfide
 
* smiles:
 
* smiles:
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
+
** [sh2]
 
* inchi-key:
 
* inchi-key:
** rqmcndrmpzbeod-uhfffaoysa-k
+
** rwsotubldixvet-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 217.112
+
** 34.076
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2464]]
+
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ACSERLY-RXN]]
 +
* [[RXN-9384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2464]]
+
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ACSERLY-RXN]]
 +
* [[DCYSDESULF-RXN]]
 +
* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
 +
* [[LCYSDESULF-RXN]]
 +
* [[MERCAPYSTRANS-RXN]]
 +
* [[RXN-15129]]
 +
* [[RXN-15148]]
 +
* [[RXN-9384]]
 +
* [[SULFITE-REDUCT-RXN]]
 +
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+
{{#set: common-name=hydrogen sulfide}}
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=rwsotubldixvet-uhfffaoysa-n}}
{{#set: molecular-weight=217.112}}
+
{{#set: molecular-weight=34.076}}

Revision as of 14:59, 5 January 2021

Metabolite HS

  • common-name:
    • hydrogen sulfide
  • smiles:
    • [sh2]
  • inchi-key:
    • rwsotubldixvet-uhfffaoysa-n
  • molecular-weight:
    • 34.076

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality