Difference between revisions of "3-oxo-palmitoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
(Created page with "Category:metabolite == Metabolite 3-oxo-palmitoyl-ACPs == * common-name: ** a 3-oxo-palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9540 == React...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2500 ==
+
== Metabolite 3-oxo-palmitoyl-ACPs ==
 
* common-name:
 
* common-name:
** p-nitrophenyl-α-d-galactopyranoside
+
** a 3-oxo-palmitoyl-[acp]
* smiles:
 
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
 
* inchi-key:
 
** ifbhrqdfsncloz-iirvcbmxsa-n
 
* molecular-weight:
 
** 301.252
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17830]]
+
* [[RXN-9540]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9539]]
 +
* [[RXN-9654]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
+
{{#set: common-name=a 3-oxo-palmitoyl-[acp]}}
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
 
{{#set: molecular-weight=301.252}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-oxo-palmitoyl-ACPs

  • common-name:
    • a 3-oxo-palmitoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-palmitoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.