Difference between revisions of "3-oxo-palmitoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...")
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite VibB ==
+
== Metabolite CPD0-2500 ==
 
* common-name:
 
* common-name:
** an apo-[vibb aryl-carrier protein]
+
** p-nitrophenyl-α-d-galactopyranoside
 +
* smiles:
 +
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
 +
* inchi-key:
 +
** ifbhrqdfsncloz-iirvcbmxsa-n
 +
* molecular-weight:
 +
** 301.252
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10994]]
+
* [[RXN-17830]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10994]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an apo-[vibb aryl-carrier protein]}}
+
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
 +
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
 +
{{#set: molecular-weight=301.252}}

Revision as of 14:58, 5 January 2021

Metabolite CPD0-2500

  • common-name:
    • p-nitrophenyl-α-d-galactopyranoside
  • smiles:
    • c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
  • inchi-key:
    • ifbhrqdfsncloz-iirvcbmxsa-n
  • molecular-weight:
    • 301.252

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality