Difference between revisions of "3-oxo-palmitoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-arabinopyranose == == Reaction(s) known to consume the compound == * RXN-8772 == Reaction(s) known to produce the compound == * R...") |
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15653 == |
| + | * common-name: | ||
| + | ** (3r)-hydroxy, 6-cis-tridecenoyl-coa | ||
| + | * smiles: | ||
| + | ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** adzjvtnixnsngu-ukoyhulusa-j | ||
| + | * molecular-weight: | ||
| + | ** 973.818 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14772]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}} | ||
| + | {{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}} | ||
| + | {{#set: molecular-weight=973.818}} | ||
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-15653
- common-name:
- (3r)-hydroxy, 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- adzjvtnixnsngu-ukoyhulusa-j
- molecular-weight:
- 973.818
