Difference between revisions of "3-oxo-stearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)...")
(Created page with "Category:metabolite == Metabolite 3-oxo-stearoyl-ACPs == * common-name: ** a 3-oxo-stearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9633 == Reactio...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UBIQUINOL-30 ==
+
== Metabolite 3-oxo-stearoyl-ACPs ==
 
* common-name:
 
* common-name:
** ubiquinol-6
+
** a 3-oxo-stearoyl-[acp]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
 
* inchi-key:
 
** dyoscpiqeyrqeo-lphqiwjtsa-n
 
* molecular-weight:
 
** 592.901
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9633]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-102]]
+
* [[RXN-9632]]
 +
* [[RXN3O-1803]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-6}}
+
{{#set: common-name=a 3-oxo-stearoyl-[acp]}}
{{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}}
 
{{#set: molecular-weight=592.901}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 3-oxo-stearoyl-ACPs

  • common-name:
    • a 3-oxo-stearoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-stearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.