Difference between revisions of "3-oxo-stearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-81 RXN66-81] == * direction: ** left-to-right * common-name: ** n,n-dimethylaniline monooxyge...")
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-81 RXN66-81] ==
+
== Metabolite CPD-7222 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** n,n-dimethylaniline monooxygenase
+
** (2e)-dodec-2-enoyl-coa
−
** nicotine monooxygenase
+
* smiles:
−
* ec-number:
+
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
−
** [http://enzyme.expasy.org/EC/1.14.13.8 ec-1.14.13.8]
+
* inchi-key:
−
== Reaction formula ==
+
** irfyvbulxzmede-xcfippspsa-j
−
* 1 [[NADPH]][c] '''+''' 1 [[NICOTINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-2743]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 943.792
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ16259]]
+
* [[ECOAH5]]
−
** Category: [[annotation]]
+
* [[ECOAH5h]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ECOAH5m]]
−
* Gene: [[SJ13227]]
+
* [[RXN-14262]]
−
** Category: [[annotation]]
+
* [[RXN-7931]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[ACOA120OR]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ECOAH5]]
−
* Gene: [[SJ12236]]
+
* [[ECOAH5h]]
−
** Category: [[annotation]]
+
* [[ECOAH5m]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14262]]
−
** Category: [[orthology]]
+
* [[RXN-7931]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ00867]]
+
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=943.792}}
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ01518]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
 
−
** '''3''' reactions found over '''16''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=n,n-dimethylaniline monooxygenase|nicotine monooxygenase}}
 
−
{{#set: ec-number=ec-1.14.13.8}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-7222

  • common-name:
    • (2e)-dodec-2-enoyl-coa
  • smiles:
    • cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • irfyvbulxzmede-xcfippspsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-oxo-stearoyl-ACPs&oldid=47971"