Difference between revisions of "3-oxo-stearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XYLITOL == * common-name: ** xylitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: ** hebkchpvoiaqta-scdxwvjysa-n * molecular-weight: ** 1...")
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XYLITOL ==
+
== Metabolite UBIQUINOL-30 ==
 
* common-name:
 
* common-name:
** xylitol
+
** ubiquinol-6
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(o)co
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
 
* inchi-key:
 
* inchi-key:
** hebkchpvoiaqta-scdxwvjysa-n
+
** dyoscpiqeyrqeo-lphqiwjtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 152.147
+
** 592.901
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.3.41-RXN]]
 
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
* [[RXN-8773]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
* [[RXN3O-102]]
* [[RXN-8773]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xylitol}}
+
{{#set: common-name=ubiquinol-6}}
{{#set: inchi-key=inchikey=hebkchpvoiaqta-scdxwvjysa-n}}
+
{{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}}
{{#set: molecular-weight=152.147}}
+
{{#set: molecular-weight=592.901}}

Revision as of 13:12, 14 January 2021

Metabolite UBIQUINOL-30

  • common-name:
    • ubiquinol-6
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
  • inchi-key:
    • dyoscpiqeyrqeo-lphqiwjtsa-n
  • molecular-weight:
    • 592.901

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality