Difference between revisions of "34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2105 ==
+
== Metabolite GDP-L-GALACTOSE ==
 
* common-name:
 
* common-name:
** 3-oxododecanoyl-coa
+
** gdp-β-l-galactose
 
* smiles:
 
* smiles:
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** hqanbzhvwidnqz-gmhmeamdsa-j
+
** mvmscbbuihutgj-jgqubwhwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 959.791
+
** 603.329
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD5]]
+
* [[RXN-1882]]
* [[HACD5h]]
+
* [[RXN4FS-12]]
* [[HACD5m]]
+
* [[RXN4FS-13]]
* [[RXN-14274]]
+
* [[RXNQT-4141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HACD5]]
+
* [[RXN-1882]]
* [[HACD5h]]
 
* [[HACD5m]]
 
* [[RXN-14274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxododecanoyl-coa}}
+
{{#set: common-name=gdp-β-l-galactose}}
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}}
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=603.329}}

Revision as of 11:17, 15 January 2021

Metabolite GDP-L-GALACTOSE

  • common-name:
    • gdp-β-l-galactose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
  • inchi-key:
    • mvmscbbuihutgj-jgqubwhwsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality