Difference between revisions of "34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite 34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY == * common-name: ** 3,4-dehydrothiomorpholine-3-carboxylate * smiles: ** c1(cscc(=n1)c(=o)[o-]) *...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD0-2105 ==
+
== Metabolite 34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY ==
 
* common-name:
 
* common-name:
−
** 3-oxododecanoyl-coa
+
** 3,4-dehydrothiomorpholine-3-carboxylate
 
* smiles:
 
* smiles:
−
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(cscc(=n1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
−
** hqanbzhvwidnqz-gmhmeamdsa-j
+
** hrxjcqxgahsujc-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 959.791
+
** 144.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[HACD5]]
+
* [[1.5.1.25-RXN]]
−
* [[HACD5h]]
 
−
* [[HACD5m]]
 
−
* [[RXN-14274]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[HACD5]]
 
−
* [[HACD5h]]
 
−
* [[HACD5m]]
 
−
* [[RXN-14274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxododecanoyl-coa}}
+
{{#set: common-name=3,4-dehydrothiomorpholine-3-carboxylate}}
−
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
+
{{#set: inchi-key=inchikey=hrxjcqxgahsujc-uhfffaoysa-m}}
−
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=144.168}}

Latest revision as of 11:15, 18 March 2021

Metabolite 34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY

  • common-name:
    • 3,4-dehydrothiomorpholine-3-carboxylate
  • smiles:
    • c1(cscc(=n1)c(=o)[o-])
  • inchi-key:
    • hrxjcqxgahsujc-uhfffaoysa-m
  • molecular-weight:
    • 144.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY&oldid=138576"