Difference between revisions of "34-DIHYDROXYPHENYLACETALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-653 == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34...")
(Created page with "Category:metabolite == Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE == * common-name: ** 3,4-dihydroxyphenylacetaldehyde * smiles: ** c1(=cc(=c(o)c=c1c[ch]=o)o) * inchi-key:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-653 ==
+
== Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE ==
 
* common-name:
 
* common-name:
** (s)-nadhx
+
** 3,4-dihydroxyphenylacetaldehyde
 
* smiles:
 
* smiles:
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
+
** c1(=cc(=c(o)c=c1c[ch]=o)o)
 
* inchi-key:
 
* inchi-key:
** idbzkgqrlbfufq-vphrtnkssa-l
+
** iadqvxrmsniuel-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 681.445
+
** 152.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.1.93-RXN]]
+
* [[RXN6666-5]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12752]]
+
* [[RXN6666-4]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-nadhx}}
+
{{#set: common-name=3,4-dihydroxyphenylacetaldehyde}}
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-vphrtnkssa-l}}
+
{{#set: inchi-key=inchikey=iadqvxrmsniuel-uhfffaoysa-n}}
{{#set: molecular-weight=681.445}}
+
{{#set: molecular-weight=152.149}}

Latest revision as of 11:15, 18 March 2021

Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylacetaldehyde
  • smiles:
    • c1(=cc(=c(o)c=c1c[ch]=o)o)
  • inchi-key:
    • iadqvxrmsniuel-uhfffaoysa-n
  • molecular-weight:
    • 152.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality