Difference between revisions of "34-Dihydroxy-5-Polyprenylbenzoates"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12462 == * transcription-direction: ** positive * right-end-position: ** 4339 * left-end-position: ** 686 * centisome-position: ** 4.238492 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1o)=o)o)o) * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-1242 == |
− | * | + | * common-name: |
− | ** | + | ** 3-keto-β-d-galactose |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(c(c(c1o)=o)o)o) |
− | * | + | * inchi-key: |
− | ** | + | ** apiqnbnbiiccon-fkmsrsahsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 178.141 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[KETOLACTOSE-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-keto-β-d-galactose}} | |
− | + | {{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}} | |
− | + | {{#set: molecular-weight=178.141}} | |
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-1242
- common-name:
- 3-keto-β-d-galactose
- smiles:
- c(o)c1(oc(c(c(c1o)=o)o)o)
- inchi-key:
- apiqnbnbiiccon-fkmsrsahsa-n
- molecular-weight:
- 178.141