Difference between revisions of "3OH-4P-OH-ALPHA-KETOBUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9003 RXN-9003] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:metabolite == Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE == * common-name: ** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate * smiles: ** c(c(c(c([o-])=o)=o)o)op([o-])(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9003 RXN-9003] ==
+
== Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE ==
* direction:
+
* common-name:
** left-to-right
+
** (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.39 ec-2.5.1.39]
+
** c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[ALL-TRANS-HEXAPRENYL-DIPHOSPHATE]][c] '''=>''' 1 [[3-HEXAPRENYL-4-HYDROXYBENZOATE]][c] '''+''' 1 [[PPI]][c]
+
** mzjfvxdtnbhtkz-uwtatzphsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 211.045
* Gene: [[SJ10781]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[PSERTRANSAMPYR-RXN]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PSERTRANSAMPYR-RXN]]
* Gene: [[SJ10418]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=(3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate}}
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=mzjfvxdtnbhtkz-uwtatzphsa-k}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=211.045}}
* Gene: [[SJ04442]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ03479]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ19255]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-7235]], superpathway of ubiquinol-6 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7235 PWY-7235]
 
** '''3''' reactions found over '''n.a''' reactions in the full pathway
 
* [[PWY3O-19]], ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-19 PWY3O-19]
 
** '''4''' reactions found over '''8''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44557 44557]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R05616 R05616]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-2.5.1.39}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE

  • common-name:
    • (3r)-3-hydroxy-2-oxo-4 phosphooxybutanoate
  • smiles:
    • c(c(c(c([o-])=o)=o)o)op([o-])(=o)[o-]
  • inchi-key:
    • mzjfvxdtnbhtkz-uwtatzphsa-k
  • molecular-weight:
    • 211.045

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality