Difference between revisions of "3R-11Z-3-hydroxy-icos-11-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...") |
(Created page with "Category:metabolite == Metabolite 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs == * common-name: ** a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp] == Reaction(s) known to consume the com...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16631]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16630]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs
- common-name:
- a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
