Difference between revisions of "3R-11Z-3-hydroxy-icos-11-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15145 == * transcription-direction: ** negative * right-end-position: ** 54558 * left-end-position: ** 45549 * centisome-position: ** 15.132507...") |
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12365 == |
− | * | + | * common-name: |
− | ** | + | ** 8-oxo-dgmp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** aqivlflyhyfrku-vpeninkcsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 361.207 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14205]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-11396]] |
− | + | * [[RXN-12816]] | |
− | + | * [[RXN-14205]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=8-oxo-dgmp}} | |
− | + | {{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}} | |
− | * [[RXN- | + | {{#set: molecular-weight=361.207}} |
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-12365
- common-name:
- 8-oxo-dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- aqivlflyhyfrku-vpeninkcsa-l
- molecular-weight:
- 361.207