Difference between revisions of "3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs == * common-name: ** a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp] == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16619]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs
- common-name:
- a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r,5z)-3-hydroxy-tetradec-5-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
