Difference between revisions of "3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * mol...") |
(Created page with "Category:metabolite == Metabolite Protein-N-terminal-L-threonine == * common-name: ** an n-terminal l-threonyl-[protein] == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-N-terminal-L-threonine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal l-threonyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17877]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal l-threonyl-[protein]}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite Protein-N-terminal-L-threonine
- common-name:
- an n-terminal l-threonyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal l-threonyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
